C13H17N3OS3 — CID 52574666
[(1R)-1-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl] N,N-diethylcarbamodithioate (PubChem CID 52574666) has the molecular formula C13H17N3OS3 and a molecular weight of 327.50 g/mol. Its IUPAC name is [(1R)-1-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl] N,N-diethylcarbamodithioate.
| Compound Name | [(1R)-1-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 52574666 |
| Molecular Formula | C13H17N3OS3 |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | [(1R)-1-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C)c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C13H17N3OS3/c1-4-16(5-2)13(18)20-9(3)12-14-11(15-17-12)10-7-6-8-19-10/h6-9H,4-5H2,1-3H3/t9-/m1/s1 |
| InChIKey | SWJAYKOYZGBYSJ-SECBINFHSA-N |
| XLogP | 4.22 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|