C9H4F6N2OS — CID 19334507
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 19334507) has the molecular formula C9H4F6N2OS and a molecular weight of 302.20 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19334507 |
| Molecular Formula | C9H4F6N2OS |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | FC(F)(F)C(c1nc(-c2cccs2)no1)C(F)(F)F |
| InChI | InChI=1S/C9H4F6N2OS/c10-8(11,12)5(9(13,14)15)7-16-6(17-18-7)4-2-1-3-19-4/h1-3,5H |
| InChIKey | XLTAIYJPGXWSIL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |