C9H5F6N3S — CID 103310053
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 103310053) has the molecular formula C9H5F6N3S and a molecular weight of 301.22 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 103310053 |
| Molecular Formula | C9H5F6N3S |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | FC(F)(F)C(c1nc(-c2cccs2)n[nH]1)C(F)(F)F |
| InChI | InChI=1S/C9H5F6N3S/c10-8(11,12)5(9(13,14)15)7-16-6(17-18-7)4-2-1-3-19-4/h1-3,5H,(H,16,17,18) |
| InChIKey | BZXGMPYLSRYYEY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |