C8H7N3O2S — CID 62733596
2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)acetic acid (PubChem CID 62733596) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)acetic acid.
| Compound Name | 2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 62733596 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)acetic acid |
| SMILES | O=C(O)Cc1nc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C8H7N3O2S/c12-7(13)4-6-9-8(11-10-6)5-2-1-3-14-5/h1-3H,4H2,(H,12,13)(H,9,10,11) |
| InChIKey | KQIUQXMIHFTCFH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |