C17H13N3S — CID 62732819
5-(naphthalen-1-ylmethyl)-3-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 62732819) has the molecular formula C17H13N3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 5-(naphthalen-1-ylmethyl)-3-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 5-(naphthalen-1-ylmethyl)-3-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 62732819 |
| Molecular Formula | C17H13N3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-(naphthalen-1-ylmethyl)-3-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | c1csc(-c2n[nH]c(Cc3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C17H13N3S/c1-2-8-14-12(5-1)6-3-7-13(14)11-16-18-17(20-19-16)15-9-4-10-21-15/h1-10H,11H2,(H,18,19,20) |
| InChIKey | RRODWHPIHXSMRO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |