C10H13N3OS — CID 62735263
5-(2-ethoxyethyl)-3-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 62735263) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-3-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 5-(2-ethoxyethyl)-3-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 62735263 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-(2-ethoxyethyl)-3-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | CCOCCc1nc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C10H13N3OS/c1-2-14-6-5-9-11-10(13-12-9)8-4-3-7-15-8/h3-4,7H,2,5-6H2,1H3,(H,11,12,13) |
| InChIKey | DPQCLQKMIUQUQC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|