C8H9N3S2 — CID 9118339
3-ethylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 9118339) has the molecular formula C8H9N3S2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-ethylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 3-ethylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 9118339 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 3-ethylsulfanyl-5-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | CCSc1n[nH]c(-c2cccs2)n1 |
| InChI | InChI=1S/C8H9N3S2/c1-2-12-8-9-7(10-11-8)6-4-3-5-13-6/h3-5H,2H2,1H3,(H,9,10,11) |
| InChIKey | XSTVHGSCVUUJCJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |