C13H10BrN3S — CID 62733022
5-[(3-bromophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 62733022) has the molecular formula C13H10BrN3S and a molecular weight of 320.21 g/mol. Its IUPAC name is 5-[(3-bromophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 5-[(3-bromophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 62733022 |
| Molecular Formula | C13H10BrN3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 5-[(3-bromophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | Brc1cccc(Cc2nc(-c3cccs3)n[nH]2)c1 |
| InChI | InChI=1S/C13H10BrN3S/c14-10-4-1-3-9(7-10)8-12-15-13(17-16-12)11-5-2-6-18-11/h1-7H,8H2,(H,15,16,17) |
| InChIKey | KJXDUEZETVSUJP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |