C19H17N7O3S — CID 166195854
N'-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]oxamide (PubChem CID 166195854) has the molecular formula C19H17N7O3S and a molecular weight of 423.46 g/mol. Its IUPAC name is N'-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]oxamide.
| Compound Name | N'-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]oxamide |
|---|---|
| PubChem CID | 166195854 |
| Molecular Formula | C19H17N7O3S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N'-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-N-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]oxamide |
| SMILES | O=C(NCc1nc(-c2cccs2)n[nH]1)C(=O)NCc1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C19H17N7O3S/c27-18(20-10-15-23-17(25-24-15)13-7-4-8-30-13)19(28)21-11-16-22-14(26-29-16)9-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,27)(H,21,28)(H,23,24,25) |
| InChIKey | VMFURARTRUXILE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|