C13H17N3O2S — CID 79471994
ethyl 2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)pentanoate (PubChem CID 79471994) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is ethyl 2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)pentanoate.
| Compound Name | ethyl 2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)pentanoate |
|---|---|
| PubChem CID | 79471994 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | ethyl 2-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)pentanoate |
| SMILES | CCCC(C(=O)OCC)c1nc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C13H17N3O2S/c1-3-6-9(13(17)18-4-2)11-14-12(16-15-11)10-7-5-8-19-10/h5,7-9H,3-4,6H2,1-2H3,(H,14,15,16) |
| InChIKey | OSAQAVDAPJFAMB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |