C10H6BrNO2S2 — CID 102823822
3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid (PubChem CID 102823822) has the molecular formula C10H6BrNO2S2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid.
| Compound Name | 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 102823822 |
| Molecular Formula | C10H6BrNO2S2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 314.90 |
| IUPAC Name | 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(Sc2nccs2)c1 |
| InChI | InChI=1S/C10H6BrNO2S2/c11-7-3-6(9(13)14)4-8(5-7)16-10-12-1-2-15-10/h1-5H,(H,13,14) |
| InChIKey | JXGZHUCSUHUDPO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|