3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid

C10H6BrNO2S2 — CID 102823822

IUPAC3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid
SMILESO=C(O)c1cc(Br)cc(Sc2nccs2)c1
InChIInChI=1S/C10H6BrNO2S2/c11-7-3-6(9(13)14)4-8(5-7)16-10-12-1-2-15-10/h1-5H,(H,13,14)
InChIKeyJXGZHUCSUHUDPO-UHFFFAOYSA-N
MW316.20 g/mol
LogP3.76
Rot. Bonds3

About 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid

3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid (PubChem CID 102823822) has the molecular formula C10H6BrNO2S2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid.

Molecular Properties

Compound Name3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid
PubChem CID102823822
Molecular FormulaC10H6BrNO2S2
Molecular Weight316.20 g/mol
Exact Mass314.90
IUPAC Name3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid
SMILESO=C(O)c1cc(Br)cc(Sc2nccs2)c1
InChIInChI=1S/C10H6BrNO2S2/c11-7-3-6(9(13)14)4-8(5-7)16-10-12-1-2-15-10/h1-5H,(H,13,14)
InChIKeyJXGZHUCSUHUDPO-UHFFFAOYSA-N
XLogP3.76
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.20
LogP ≤ 53.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}

Analyze 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid?
The IUPAC name of 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid (CID 102823822) is 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid.
What is the SMILES notation for 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid?
The canonical SMILES for 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid is O=C(O)c1cc(Br)cc(Sc2nccs2)c1.
What is the InChIKey of 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid?
The InChIKey is JXGZHUCSUHUDPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrNO2S2/c11-7-3-6(9(13)14)4-8(5-7)16-10-12-1-2-15-10/h1-5H,(H,13,14).
What are the key properties of 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid?
3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid has a molecular weight of 316.20 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(1,3-thiazol-2-ylsulfanyl)benzoic acid is sourced from PubChem (CID 102823822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).