C11H7BrFNO4S2 — CID 43323072
5-bromo-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid (PubChem CID 43323072) has the molecular formula C11H7BrFNO4S2 and a molecular weight of 380.22 g/mol. Its IUPAC name is 5-bromo-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid.
| Compound Name | 5-bromo-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43323072 |
| Molecular Formula | C11H7BrFNO4S2 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | 5-bromo-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)(=O)Cc2cscn2)c1F |
| InChI | InChI=1S/C11H7BrFNO4S2/c12-6-1-8(11(15)16)10(13)9(2-6)20(17,18)4-7-3-19-5-14-7/h1-3,5H,4H2,(H,15,16) |
| InChIKey | BHZVAYURKZBMSO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |