C10H8N2O4S — CID 28914515
5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]furan-2-carboxylic acid (PubChem CID 28914515) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 28914515 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CSc2nccc(=O)[nH]2)o1 |
| InChI | InChI=1S/C10H8N2O4S/c13-8-3-4-11-10(12-8)17-5-6-1-2-7(16-6)9(14)15/h1-4H,5H2,(H,14,15)(H,11,12,13) |
| InChIKey | ZKHREYRBUVRXAO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |