C13H15Cl3N4S — CID 7746498
3-butyl-5-[(2,3,6-trichlorophenyl)methylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 7746498) has the molecular formula C13H15Cl3N4S and a molecular weight of 365.72 g/mol. Its IUPAC name is 3-butyl-5-[(2,3,6-trichlorophenyl)methylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-butyl-5-[(2,3,6-trichlorophenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 7746498 |
| Molecular Formula | C13H15Cl3N4S |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 3-butyl-5-[(2,3,6-trichlorophenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | CCCCc1nnc(SCc2c(Cl)ccc(Cl)c2Cl)n1N |
| InChI | InChI=1S/C13H15Cl3N4S/c1-2-3-4-11-18-19-13(20(11)17)21-7-8-9(14)5-6-10(15)12(8)16/h5-6H,2-4,7,17H2,1H3 |
| InChIKey | BCDIHZPRPDSJCX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|