C15H18FN3O3S2 — CID 17473541
3-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide (PubChem CID 17473541) has the molecular formula C15H18FN3O3S2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 17473541 |
| Molecular Formula | C15H18FN3O3S2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
| SMILES | Cn1c(SCCOc2ccc(F)cc2)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18FN3O3S2/c1-19-14(11-6-9-24(20,21)10-11)17-18-15(19)23-8-7-22-13-4-2-12(16)3-5-13/h2-5,11H,6-10H2,1H3 |
| InChIKey | BWIHMFHCBVDZLL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|