C16H20ClN3O3S2 — CID 78677976
3-[[5-[2-(4-chlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide (PubChem CID 78677976) has the molecular formula C16H20ClN3O3S2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 3-[[5-[2-(4-chlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[[5-[2-(4-chlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 78677976 |
| Molecular Formula | C16H20ClN3O3S2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 3-[[5-[2-(4-chlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methyl]thiolane 1,1-dioxide |
| SMILES | Cn1c(CC2CCS(=O)(=O)C2)nnc1SCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O3S2/c1-20-15(10-12-6-9-25(21,22)11-12)18-19-16(20)24-8-7-23-14-4-2-13(17)3-5-14/h2-5,12H,6-11H2,1H3 |
| InChIKey | DJDDYYDBRHJSGQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|