C19H25N3O4S2 — CID 36792871
(3R)-3-[5-[3-(4-methoxyphenoxy)propylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide (PubChem CID 36792871) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (3R)-3-[5-[3-(4-methoxyphenoxy)propylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide.
| Compound Name | (3R)-3-[5-[3-(4-methoxyphenoxy)propylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 36792871 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (3R)-3-[5-[3-(4-methoxyphenoxy)propylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
| SMILES | C=CCn1c(SCCCOc2ccc(OC)cc2)nnc1[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H25N3O4S2/c1-3-10-22-18(15-9-13-28(23,24)14-15)20-21-19(22)27-12-4-11-26-17-7-5-16(25-2)6-8-17/h3,5-8,15H,1,4,9-14H2,2H3/t15-/m0/s1 |
| InChIKey | GAHTWOJYDWUFKP-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|