C17H21N3O4S2 — CID 102565696
3-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thiolane 1,1-dioxide (PubChem CID 102565696) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 3-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thiolane 1,1-dioxide.
| Compound Name | 3-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 102565696 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]thiolane 1,1-dioxide |
| SMILES | C=CCn1c(COc2ccc(OC)cc2)nnc1SC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-3-9-20-16(11-24-14-6-4-13(23-2)5-7-14)18-19-17(20)25-15-8-10-26(21,22)12-15/h3-7,15H,1,8-12H2,2H3 |
| InChIKey | URELRBGQVCMHGS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|