C18H21N5O4S2 — CID 97067903
(3S)-3-[5-[[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide (PubChem CID 97067903) has the molecular formula C18H21N5O4S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (3S)-3-[5-[[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide.
| Compound Name | (3S)-3-[5-[[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 97067903 |
| Molecular Formula | C18H21N5O4S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (3S)-3-[5-[[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
| SMILES | C=CCn1c(SCc2nnc(-c3cc(C)oc3C)o2)nnc1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H21N5O4S2/c1-4-6-23-16(13-5-7-29(24,25)10-13)20-22-18(23)28-9-15-19-21-17(27-15)14-8-11(2)26-12(14)3/h4,8,13H,1,5-7,9-10H2,2-3H3/t13-/m1/s1 |
| InChIKey | SEMLNJADADIPEE-CYBMUJFWSA-N |
| XLogP | 2.92 |
| TPSA | 116.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|