C14H21N7O2S2 — CID 24574082
3-[4-prop-2-enyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide (PubChem CID 24574082) has the molecular formula C14H21N7O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[4-prop-2-enyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[4-prop-2-enyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 24574082 |
| Molecular Formula | C14H21N7O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-[4-prop-2-enyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
| SMILES | C=CCn1c(SCc2nnnn2CCC)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H21N7O2S2/c1-3-6-20-13(11-5-8-25(22,23)10-11)16-17-14(20)24-9-12-15-18-19-21(12)7-4-2/h3,11H,1,4-10H2,2H3 |
| InChIKey | KVWDUHRWKSGWHZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|