C19H21N3O2S — CID 112778095
3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-(2-methylphenyl)-1,2,4-triazole (PubChem CID 112778095) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-(2-methylphenyl)-1,2,4-triazole.
| Compound Name | 3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-(2-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 112778095 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-4-(2-methylphenyl)-1,2,4-triazole |
| SMILES | CCOc1ccc(OCCSc2nncn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-3-23-16-8-10-17(11-9-16)24-12-13-25-19-21-20-14-22(19)18-7-5-4-6-15(18)2/h4-11,14H,3,12-13H2,1-2H3 |
| InChIKey | QQZBADXWMOYWIJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|