C14H15N5O2S — CID 38895633
3-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione (PubChem CID 38895633) has the molecular formula C14H15N5O2S and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 38895633 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccccc1-n1cnnc1SCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C14H15N5O2S/c1-10-4-2-3-5-11(10)19-9-16-17-14(19)22-7-6-18-12(20)8-15-13(18)21/h2-5,9H,6-8H2,1H3,(H,15,21) |
| InChIKey | QSAKRGNYASLALB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|