C14H15NO3S2 — CID 63097712
2-[4-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]phenyl]acetic acid (PubChem CID 63097712) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[4-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 63097712 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[4-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]phenyl]acetic acid |
| SMILES | Cc1csc(SCCOc2ccc(CC(=O)O)cc2)n1 |
| InChI | InChI=1S/C14H15NO3S2/c1-10-9-20-14(15-10)19-7-6-18-12-4-2-11(3-5-12)8-13(16)17/h2-5,9H,6-8H2,1H3,(H,16,17) |
| InChIKey | DXZIICNVRYVXFU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|