C21H21NO4S2 — CID 7362088
2-(4-methoxyphenoxy)ethyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 7362088) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7362088 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | COc1ccc(OCCOC(=O)c2ccccc2CSc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C21H21NO4S2/c1-15-13-27-21(22-15)28-14-16-5-3-4-6-19(16)20(23)26-12-11-25-18-9-7-17(24-2)8-10-18/h3-10,13H,11-12,14H2,1-2H3 |
| InChIKey | KOAPICTWKNTMSZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|