C18H17N3O3S2 — CID 7247236
[(3S)-3-cyano-4-imino-2-oxopentyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 7247236) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is [(3S)-3-cyano-4-imino-2-oxopentyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | [(3S)-3-cyano-4-imino-2-oxopentyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7247236 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [(3S)-3-cyano-4-imino-2-oxopentyl] 2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | [H]/N=C(\C)[C@@H](C#N)C(=O)COC(=O)c1ccccc1CSc1nc(C)cs1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-11-9-25-18(21-11)26-10-13-5-3-4-6-14(13)17(23)24-8-16(22)15(7-19)12(2)20/h3-6,9,15,20H,8,10H2,1-2H3/b20-12+/t15-/m1/s1 |
| InChIKey | LSEIFFSNTHPQLD-RVZJCZPVSA-N |
| XLogP | 3.65 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|