C11H10ClNOS2 — CID 60563953
2-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3-thiazole (PubChem CID 60563953) has the molecular formula C11H10ClNOS2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 2-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3-thiazole.
| Compound Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 60563953 |
| Molecular Formula | C11H10ClNOS2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-1,3-thiazole |
| SMILES | Clc1cccc(OCCSc2nccs2)c1 |
| InChI | InChI=1S/C11H10ClNOS2/c12-9-2-1-3-10(8-9)14-5-7-16-11-13-4-6-15-11/h1-4,6,8H,5,7H2 |
| InChIKey | DIGMJQBQYRTBQT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|