C15H20ClIN4S2 — CID 111828224
1-[(3-chlorophenyl)methyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide (PubChem CID 111828224) has the molecular formula C15H20ClIN4S2 and a molecular weight of 482.84 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111828224 |
| Molecular Formula | C15H20ClIN4S2 |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCSc1nccs1)NCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C15H19ClN4S2.HI/c1-17-14(20-11-12-4-2-5-13(16)10-12)18-6-3-8-21-15-19-7-9-22-15;/h2,4-5,7,9-10H,3,6,8,11H2,1H3,(H2,17,18,20);1H |
| InChIKey | PCFDBCWSUMFUOR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|