C16H19F3N4S2 — CID 111832527
2-methyl-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111832527) has the molecular formula C16H19F3N4S2 and a molecular weight of 388.48 g/mol. Its IUPAC name is 2-methyl-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111832527 |
| Molecular Formula | C16H19F3N4S2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-methyl-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCCSc1nccs1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N4S2/c1-20-14(21-7-2-9-24-15-22-8-10-25-15)23-11-12-3-5-13(6-4-12)16(17,18)19/h3-6,8,10H,2,7,9,11H2,1H3,(H2,20,21,23) |
| InChIKey | ZYPKIZXCPTZLGI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|