C12H12N4OS — CID 43289942
4-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propoxy]benzonitrile (PubChem CID 43289942) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propoxy]benzonitrile.
| Compound Name | 4-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 43289942 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-[3-(1H-1,2,4-triazol-5-ylsulfanyl)propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCSc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H12N4OS/c13-8-10-2-4-11(5-3-10)17-6-1-7-18-12-14-9-15-16-12/h2-5,9H,1,6-7H2,(H,14,15,16) |
| InChIKey | MBOYEEWVOADBQG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|