C18H19NOS — CID 43290018
4-[3-(3,4-dimethylphenyl)sulfanylpropoxy]benzonitrile (PubChem CID 43290018) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylphenyl)sulfanylpropoxy]benzonitrile.
| Compound Name | 4-[3-(3,4-dimethylphenyl)sulfanylpropoxy]benzonitrile |
|---|---|
| PubChem CID | 43290018 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-[3-(3,4-dimethylphenyl)sulfanylpropoxy]benzonitrile |
| SMILES | Cc1ccc(SCCCOc2ccc(C#N)cc2)cc1C |
| InChI | InChI=1S/C18H19NOS/c1-14-4-9-18(12-15(14)2)21-11-3-10-20-17-7-5-16(13-19)6-8-17/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | IPDXALFIWDESQL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|