C15H21N3O2S — CID 36823507
4-butyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 36823507) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-butyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-butyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 36823507 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-butyl-3-[2-(3-methylphenoxy)ethylsulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCCCn1c(SCCOc2cccc(C)c2)n[nH]c1=O |
| InChI | InChI=1S/C15H21N3O2S/c1-3-4-8-18-14(19)16-17-15(18)21-10-9-20-13-7-5-6-12(2)11-13/h5-7,11H,3-4,8-10H2,1-2H3,(H,16,19) |
| InChIKey | KNTPZTZTYBVKCZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|