C12H14BrN5O2S — CID 82787169
3-bromo-N'-hydroxy-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide (PubChem CID 82787169) has the molecular formula C12H14BrN5O2S and a molecular weight of 372.25 g/mol. Its IUPAC name is 3-bromo-N'-hydroxy-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 3-bromo-N'-hydroxy-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 82787169 |
| Molecular Formula | C12H14BrN5O2S |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 3-bromo-N'-hydroxy-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
| SMILES | CCCn1c(Sc2ccc(/C(N)=N/O)cc2Br)n[nH]c1=O |
| InChI | InChI=1S/C12H14BrN5O2S/c1-2-5-18-11(19)15-16-12(18)21-9-4-3-7(6-8(9)13)10(14)17-20/h3-4,6,20H,2,5H2,1H3,(H2,14,17)(H,15,19) |
| InChIKey | LTURSUMXZAAOQG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|