C13H17N5O2S — CID 82989406
3-amino-4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzamide (PubChem CID 82989406) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 3-amino-4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82989406 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-amino-4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzamide |
| SMILES | CCn1c(Sc2ccc(C(=O)N(C)C)cc2N)n[nH]c1=O |
| InChI | InChI=1S/C13H17N5O2S/c1-4-18-12(20)15-16-13(18)21-10-6-5-8(7-9(10)14)11(19)17(2)3/h5-7H,4,14H2,1-3H3,(H,15,20) |
| InChIKey | URXOTKYZYMROBP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|