C12H15N5O2S — CID 82990246
3-amino-N,N-dimethyl-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide (PubChem CID 82990246) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide.
| Compound Name | 3-amino-N,N-dimethyl-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 82990246 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-amino-N,N-dimethyl-4-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(Sc2n[nH]c(=O)n2C)c(N)c1 |
| InChI | InChI=1S/C12H15N5O2S/c1-16(2)10(18)7-4-5-9(8(13)6-7)20-12-15-14-11(19)17(12)3/h4-6H,13H2,1-3H3,(H,14,19) |
| InChIKey | XYLHFDPZAHXDAO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|