About 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one
3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 62883796) has the molecular formula C7H12N6OS
and a molecular weight of 228.28 g/mol. Its IUPAC name is 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| PubChem CID | 62883796 |
| Molecular Formula | C7H12N6OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)n1c(SCCN=[N+]=[N-])n[nH]c1=O |
| InChI | InChI=1S/C7H12N6OS/c1-5(2)13-6(14)10-11-7(13)15-4-3-9-12-8/h5H,3-4H2,1-2H3,(H,10,14) |
| InChIKey | QTALUIMZJFEUIE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one (CID 62883796) is 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one is CC(C)n1c(SCCN=[N+]=[N-])n[nH]c1=O.
What is the InChIKey of 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The InChIKey is QTALUIMZJFEUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N6OS/c1-5(2)13-6(14)10-11-7(13)15-4-3-9-12-8/h5H,3-4H2,1-2H3,(H,10,14).
What are the key properties of 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one has a molecular weight of 228.28 g/mol, XLogP of 1.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 62883796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).