C7H12N6OS — CID 62883796
3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 62883796) has the molecular formula C7H12N6OS and a molecular weight of 228.28 g/mol. Its IUPAC name is 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62883796 |
| Molecular Formula | C7H12N6OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-(2-azidoethylsulfanyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)n1c(SCCN=[N+]=[N-])n[nH]c1=O |
| InChI | InChI=1S/C7H12N6OS/c1-5(2)13-6(14)10-11-7(13)15-4-3-9-12-8/h5H,3-4H2,1-2H3,(H,10,14) |
| InChIKey | QTALUIMZJFEUIE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|