C11H12ClN5O2 — CID 96563684
1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]triazole-4-carbohydrazide (PubChem CID 96563684) has the molecular formula C11H12ClN5O2 and a molecular weight of 281.70 g/mol. Its IUPAC name is 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 96563684 |
| Molecular Formula | C11H12ClN5O2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(C[C@@H](O)c2cccc(Cl)c2)nn1 |
| InChI | InChI=1S/C11H12ClN5O2/c12-8-3-1-2-7(4-8)10(18)6-17-5-9(15-16-17)11(19)14-13/h1-5,10,18H,6,13H2,(H,14,19)/t10-/m1/s1 |
| InChIKey | XUUMOKYCPFBBIP-SNVBAGLBSA-N |
| XLogP | 0.27 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|