C12H10N2O2S2 — CID 54251376
3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1H-pyrrole-2,5-diol (PubChem CID 54251376) has the molecular formula C12H10N2O2S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1H-pyrrole-2,5-diol.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54251376 |
| Molecular Formula | C12H10N2O2S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1H-pyrrole-2,5-diol |
| SMILES | Oc1cc(CSc2nc3ccccc3s2)c(O)[nH]1 |
| InChI | InChI=1S/C12H10N2O2S2/c15-10-5-7(11(16)14-10)6-17-12-13-8-3-1-2-4-9(8)18-12/h1-5,14-16H,6H2 |
| InChIKey | QWZKEBLJBHRALX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |