C20H26N2O2S2 — CID 54205504
3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1-octylpyrrole-2,5-diol (PubChem CID 54205504) has the molecular formula C20H26N2O2S2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1-octylpyrrole-2,5-diol.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1-octylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54205504 |
| Molecular Formula | C20H26N2O2S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-1-octylpyrrole-2,5-diol |
| SMILES | CCCCCCCCn1c(O)cc(CSc2nc3ccccc3s2)c1O |
| InChI | InChI=1S/C20H26N2O2S2/c1-2-3-4-5-6-9-12-22-18(23)13-15(19(22)24)14-25-20-21-16-10-7-8-11-17(16)26-20/h7-8,10-11,13,23-24H,2-6,9,12,14H2,1H3 |
| InChIKey | PSEZDXCVNNEECH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|