C10H9ClN4S2 — CID 102668600
3-chloro-4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzenecarboximidamide (PubChem CID 102668600) has the molecular formula C10H9ClN4S2 and a molecular weight of 284.80 g/mol. Its IUPAC name is 3-chloro-4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzenecarboximidamide.
| Compound Name | 3-chloro-4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 102668600 |
| Molecular Formula | C10H9ClN4S2 |
| Molecular Weight | 284.80 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 3-chloro-4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CSc2ncns2)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClN4S2/c11-8-3-6(9(12)13)1-2-7(8)4-16-10-14-5-15-17-10/h1-3,5H,4H2,(H3,12,13) |
| InChIKey | SUFIZPUCFQQTDR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|