C10H12N6S2 — CID 107551897
2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-methylpyrimidine-4-carboximidamide (PubChem CID 107551897) has the molecular formula C10H12N6S2 and a molecular weight of 280.38 g/mol. Its IUPAC name is 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107551897 |
| Molecular Formula | C10H12N6S2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-methylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(Sc2nc(CC)ns2)n1 |
| InChI | InChI=1S/C10H12N6S2/c1-3-7-15-10(18-16-7)17-9-13-5(2)4-6(14-9)8(11)12/h4H,3H2,1-2H3,(H3,11,12) |
| InChIKey | HFRMYCWSSPVCNJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|