About 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline
3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline (PubChem CID 66094627) has the molecular formula C10H9IN2S2
and a molecular weight of 348.23 g/mol. Its IUPAC name is 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline.
Molecular Properties
| Compound Name | 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline |
| PubChem CID | 66094627 |
| Molecular Formula | C10H9IN2S2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline |
| SMILES | Cc1csc(Sc2ccc(N)cc2I)n1 |
| InChI | InChI=1S/C10H9IN2S2/c1-6-5-14-10(13-6)15-9-3-2-7(12)4-8(9)11/h2-5H,12H2,1H3 |
| InChIKey | WPSVFZAPJPUOMI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline?
The IUPAC name of 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline (CID 66094627) is 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline.
What is the SMILES notation for 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline?
The canonical SMILES for 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline is Cc1csc(Sc2ccc(N)cc2I)n1.
What is the InChIKey of 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline?
The InChIKey is WPSVFZAPJPUOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2S2/c1-6-5-14-10(13-6)15-9-3-2-7(12)4-8(9)11/h2-5H,12H2,1H3.
What are the key properties of 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline?
3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline has a molecular weight of 348.23 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline is sourced from PubChem (CID 66094627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).