C11H9N3OS2 — CID 61371809
2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzoxazol-5-amine (PubChem CID 61371809) has the molecular formula C11H9N3OS2 and a molecular weight of 263.35 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 61371809 |
| Molecular Formula | C11H9N3OS2 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1,3-benzoxazol-5-amine |
| SMILES | Cc1csc(Sc2nc3cc(N)ccc3o2)n1 |
| InChI | InChI=1S/C11H9N3OS2/c1-6-5-16-11(13-6)17-10-14-8-4-7(12)2-3-9(8)15-10/h2-5H,12H2,1H3 |
| InChIKey | NKUJXAZMLMFGKB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|