C11H14N2O2S — CID 107770293
3-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]butan-2-ol (PubChem CID 107770293) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]butan-2-ol.
| Compound Name | 3-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 107770293 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]butan-2-ol |
| SMILES | CC(O)C(C)Sc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C11H14N2O2S/c1-6(14)7(2)16-11-13-9-5-8(12)3-4-10(9)15-11/h3-7,14H,12H2,1-2H3 |
| InChIKey | IAGDOTOJZMMPSD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|