C15H11N3OS — CID 107931886
2-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-5-methylbenzonitrile (PubChem CID 107931886) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-5-methylbenzonitrile.
| Compound Name | 2-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 107931886 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-5-methylbenzonitrile |
| SMILES | Cc1ccc(Sc2nc3cc(N)ccc3o2)c(C#N)c1 |
| InChI | InChI=1S/C15H11N3OS/c1-9-2-5-14(10(6-9)8-16)20-15-18-12-7-11(17)3-4-13(12)19-15/h2-7H,17H2,1H3 |
| InChIKey | CNMVPVUESPQVHG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|