C14H8BrN3OS — CID 82800963
4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-3-bromobenzonitrile (PubChem CID 82800963) has the molecular formula C14H8BrN3OS and a molecular weight of 346.21 g/mol. Its IUPAC name is 4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-3-bromobenzonitrile.
| Compound Name | 4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-3-bromobenzonitrile |
|---|---|
| PubChem CID | 82800963 |
| Molecular Formula | C14H8BrN3OS |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 4-[(5-amino-1,3-benzoxazol-2-yl)sulfanyl]-3-bromobenzonitrile |
| SMILES | N#Cc1ccc(Sc2nc3cc(N)ccc3o2)c(Br)c1 |
| InChI | InChI=1S/C14H8BrN3OS/c15-10-5-8(7-16)1-4-13(10)20-14-18-11-6-9(17)2-3-12(11)19-14/h1-6H,17H2 |
| InChIKey | UJEZWWCVXPHMRV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|