C14H9BrF2N2OS — CID 106269745
2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1,3-benzoxazol-5-amine (PubChem CID 106269745) has the molecular formula C14H9BrF2N2OS and a molecular weight of 371.21 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 106269745 |
| Molecular Formula | C14H9BrF2N2OS |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(SCc3c(F)ccc(Br)c3F)nc2c1 |
| InChI | InChI=1S/C14H9BrF2N2OS/c15-9-2-3-10(16)8(13(9)17)6-21-14-19-11-5-7(18)1-4-12(11)20-14/h1-5H,6,18H2 |
| InChIKey | ITBGKGDWIXWADQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|