C14H9BrF2N2O2 — CID 106263955
5-amino-3-[(3-bromo-2,6-difluorophenyl)methyl]-1,3-benzoxazol-2-one (PubChem CID 106263955) has the molecular formula C14H9BrF2N2O2 and a molecular weight of 355.14 g/mol. Its IUPAC name is 5-amino-3-[(3-bromo-2,6-difluorophenyl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 5-amino-3-[(3-bromo-2,6-difluorophenyl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 106263955 |
| Molecular Formula | C14H9BrF2N2O2 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 5-amino-3-[(3-bromo-2,6-difluorophenyl)methyl]-1,3-benzoxazol-2-one |
| SMILES | Nc1ccc2oc(=O)n(Cc3c(F)ccc(Br)c3F)c2c1 |
| InChI | InChI=1S/C14H9BrF2N2O2/c15-9-2-3-10(16)8(13(9)17)6-19-11-5-7(18)1-4-12(11)21-14(19)20/h1-5H,6,18H2 |
| InChIKey | LSXRKOTYUPHVJU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|