C11H9N3O3 — CID 60871491
5-amino-3-(1,2-oxazol-4-ylmethyl)-1,3-benzoxazol-2-one (PubChem CID 60871491) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 5-amino-3-(1,2-oxazol-4-ylmethyl)-1,3-benzoxazol-2-one.
| Compound Name | 5-amino-3-(1,2-oxazol-4-ylmethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 60871491 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-amino-3-(1,2-oxazol-4-ylmethyl)-1,3-benzoxazol-2-one |
| SMILES | Nc1ccc2oc(=O)n(Cc3cnoc3)c2c1 |
| InChI | InChI=1S/C11H9N3O3/c12-8-1-2-10-9(3-8)14(11(15)17-10)5-7-4-13-16-6-7/h1-4,6H,5,12H2 |
| InChIKey | FVFCKPVRYLSYLG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|