C13H14N4O2 — CID 103002356
5-amino-3-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazol-2-one (PubChem CID 103002356) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-amino-3-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazol-2-one.
| Compound Name | 5-amino-3-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 103002356 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5-amino-3-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazol-2-one |
| SMILES | Cn1cc(CCn2c(=O)oc3ccc(N)cc32)cn1 |
| InChI | InChI=1S/C13H14N4O2/c1-16-8-9(7-15-16)4-5-17-11-6-10(14)2-3-12(11)19-13(17)18/h2-3,6-8H,4-5,14H2,1H3 |
| InChIKey | RAGBETRJSYEMPB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|