C12H10N4OS2 — CID 65274783
2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-1,3-benzoxazol-5-amine (PubChem CID 65274783) has the molecular formula C12H10N4OS2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 65274783 |
| Molecular Formula | C12H10N4OS2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(Sc3nc(C4CC4)ns3)nc2c1 |
| InChI | InChI=1S/C12H10N4OS2/c13-7-3-4-9-8(5-7)14-11(17-9)18-12-15-10(16-19-12)6-1-2-6/h3-6H,1-2,13H2 |
| InChIKey | YVXRRNMLTQRPRG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|